CAS 2197057-62-6

6,9-Diazaspiro[4.5]decane, 9-methyl-, hydrochloride (1:2)

Description:

6,9-Diazaspiro[4.5]decane, 9-methyl-, hydrochloride (1:2) is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework containing two nitrogen atoms in its rings. This compound features a methyl group at the 9-position, contributing to its overall molecular complexity. As a hydrochloride salt, it is typically encountered in a stable, crystalline form, which enhances its solubility in polar solvents like water. The presence of the hydrochloride indicates that it can form ionic interactions, which may influence its biological activity and pharmacological properties. Compounds of this type are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological or psychological conditions. The specific arrangement of atoms and functional groups in 6,9-Diazaspiro[4.5]decane may also impart unique reactivity and interaction profiles, making it a subject of interest in synthetic organic chemistry and drug design.

Formula: C₉H₁₈N₂·2ClH

InChI: InChI=1S/C9H18N2.2ClH/c1-11-7-6-10-9(8-11)4-2-3-5-9;;/h10H,2-8H2,1H3;2*1H

InChI key: InChIKey=NBCRCDYZPHRHMF-UHFFFAOYSA-N

SMILES: CN1CC2(NCC1)CCCC2.Cl

Synonyms:

• 6,9-Diazaspiro[4.5]decane, 9-methyl-, hydrochloride (1:2)

9-Methyl-6,9-diazaspiro[4.5]decane dihydrochloride

CAS: 2197057-62-6

Formula: C₉H₂₀Cl₂N₂

Molecular weight: 227.17

Ref: 10-F476510