
CAS 2197189-38-9
:Rivaroxaban Impurity 43
Description:
Rivaroxaban Impurity 43, identified by its CAS number 2197189-38-9, is a chemical compound associated with the pharmaceutical agent rivaroxaban, which is an anticoagulant used to prevent and treat thromboembolic disorders. As an impurity, it may arise during the synthesis or degradation of rivaroxaban and is typically characterized by its molecular structure, which includes specific functional groups that can influence its chemical behavior and stability. Impurities like this are often analyzed for their potential effects on the efficacy and safety of the primary drug. The characteristics of Rivaroxaban Impurity 43 may include its solubility in various solvents, stability under different conditions, and potential reactivity with other compounds. Understanding such impurities is crucial for quality control in pharmaceutical manufacturing, as they can impact the overall therapeutic profile of the drug. Analytical techniques such as HPLC, NMR, and mass spectrometry are commonly employed to identify and quantify such impurities in drug formulations.
Formula:C19H18ClN3O6S
InChI:InChI=1S/C19H18ClN3O6S/c20-16-6-5-15(30(16)27)18(25)21-9-14-10-23(19(26)29-14)13-3-1-12(2-4-13)22-7-8-28-11-17(22)24/h1-6,14H,7-11H2,(H,21,25)/t14-,30?/m0/s1
InChI key:OIOONGBEAKOOCB-FHEMDEPNSA-N
SMILES:C1COCC(=O)N1C2=CC=C(C=C2)N3C[C@@H](OC3=O)CNC(=O)C4=CC=C(S4=O)Cl
Synonyms:- Rivaroxaban Sulfoxide
- Rivaroxaban Impurity 43
- 2-Thiophenecarboxamide, 5-chloro-N-[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

