CymitQuimica logo

CAS 219763-87-8

:

4-bromoquinoline-6-carboxylic acid

Description:
4-Bromoquinoline-6-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 4-position and a carboxylic acid group at the 6-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting the influence of the carboxylic acid functional group. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals due to its potential biological activity. The bromine substituent can enhance reactivity in electrophilic aromatic substitution reactions, while the carboxylic acid group can participate in hydrogen bonding and serve as a site for further functionalization. Additionally, the compound's structure allows for various derivatives to be synthesized, which may exhibit different physical and chemical properties. Overall, 4-bromoquinoline-6-carboxylic acid is a versatile compound with applications in research and industry.
Formula:C10H6BrNO2
InChI:InChI=1/C10H6BrNO2/c11-8-3-4-12-9-2-1-6(10(13)14)5-7(8)9/h1-5H,(H,13,14)
InChI key:LXDXJSHQARTINV-UHFFFAOYSA-N
SMILES:c1cc2c(cc1C(=O)O)c(ccn2)Br
Synonyms:
  • 6-Quinolinecarboxylic Acid, 4-Bromo-
  • 4-Bromoquinoline-6-carboxylic acid
Found 4 products.