CymitQuimica logo

CAS 21979-55-5

:

3-bromo-1-methylquinolinium

Description:
3-Bromo-1-methylquinolinium is a chemical compound characterized by its quinolinium structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 3-position and a methyl group at the 1-position contributes to its unique properties. This compound typically exhibits a yellow to orange color in solid form and is soluble in polar organic solvents. It is known for its potential applications in organic synthesis, particularly in the development of fluorescent probes and as a reagent in various chemical reactions. The bromine substituent can enhance reactivity, making it useful in electrophilic substitution reactions. Additionally, the quinolinium moiety can participate in various interactions, including hydrogen bonding and π-π stacking, which may influence its behavior in biological systems. As with many brominated compounds, it is essential to handle 3-bromo-1-methylquinolinium with care due to potential toxicity and environmental concerns associated with brominated organic compounds.
Formula:C10H9BrN
InChI:InChI=1/C10H9BrN/c1-12-7-9(11)6-8-4-2-3-5-10(8)12/h2-7H,1H3/q+1
InChI key:VAFUIIQYULSGHS-UHFFFAOYSA-M
SMILES:CN1[CH]C(=Cc2ccccc12)Br
Synonyms:
  • Quinolinium, 3-Bromo-1-Methyl-
Found 3 products.