CymitQuimica logo

CAS 219793-85-8

:

diethyl {[(2-chloropyridin-3-yl)carbonyl]amino}propanedioate

Description:
Diethyl {[(2-chloropyridin-3-yl)carbonyl]amino}propanedioate is a chemical compound characterized by its complex structure, which includes a diethyl ester group and a pyridine derivative. The presence of the 2-chloropyridine moiety suggests that it may exhibit specific biological activities, potentially related to its interaction with biological targets due to the halogen substitution. The carbonyl and amino functional groups indicate that it may participate in various chemical reactions, including acylation and amide formation. This compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and intermolecular interactions. Its solubility may vary in different solvents, influenced by the polar and nonpolar characteristics of its functional groups. Additionally, the presence of the diethyl ester suggests potential applications in medicinal chemistry, possibly as a precursor for synthesizing more complex molecules or as a bioactive agent. Safety and handling precautions should be observed due to the presence of chlorine and the potential for reactivity associated with the functional groups.
Formula:C13H15ClN2O5
InChI:InChI=1/C13H15ClN2O5/c1-3-20-12(18)9(13(19)21-4-2)16-11(17)8-6-5-7-15-10(8)14/h5-7,9H,3-4H2,1-2H3,(H,16,17)
SMILES:CCOC(=O)C(C(=O)OCC)N=C(c1cccnc1Cl)O
Synonyms:
  • Diethyl {[(2-chloropyridin-3-yl)carbonyl]amino}malonate
  • Propanedioic Acid, 2-[[(2-Chloro-3-Pyridinyl)Carbonyl]Amino]-, Diethyl Ester
Found 1 products.