CymitQuimica logo

CAS 219841-91-5

:

Benzoic acid, 5-cyano-2-iodo-, methyl ester

Description:
Benzoic acid, 5-cyano-2-iodo-, methyl ester, with the CAS number 219841-91-5, is an organic compound characterized by its functional groups and structural features. It is an ester derived from benzoic acid, where a methyl group is esterified to the carboxylic acid, and it contains both a cyano group and an iodo substituent on the aromatic ring. This compound typically exhibits a crystalline solid form and is soluble in organic solvents. The presence of the cyano group contributes to its potential reactivity, making it useful in various synthetic applications, including organic synthesis and medicinal chemistry. The iodo substituent can also enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, benzoic acid derivatives are known for their antimicrobial properties, which may extend to this compound. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks. Overall, this compound's unique structure lends itself to diverse applications in chemical research and industry.
Formula:C9H6INO2
InChI:InChI=1S/C9H6INO2/c1-13-9(12)7-4-6(5-11)2-3-8(7)10/h2-4H,1H3
InChI key:SSXDDLXAVMYVKR-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=CC(=C1)C#N)I
Found 3 products.