CymitQuimica logo

CAS 2199-47-5

:

ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate

Description:
Ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate, with the CAS number 2199-47-5, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features multiple alkyl substituents, specifically ethyl and methyl groups, which contribute to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate is soluble in organic solvents, which makes it useful in organic synthesis and potentially in pharmaceuticals or agrochemicals. Its reactivity and stability can be influenced by the steric and electronic effects of the substituents on the pyrrole ring. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c1-5-9-7(3)10(12-8(9)4)11(13)14-6-2/h12H,5-6H2,1-4H3
InChI key:GIGBRYTXWUHNAZ-UHFFFAOYSA-N
SMILES:CCc1c(C)c(C(=O)OCC)[nH]c1C
Synonyms:
  • 3,5-Dimethyl-4-ethyl-1H-pyrrole-2-carboxylic acid ethyl ester
Found 3 products.