CymitQuimica logo

CAS 2199-90-8

:

ethyl 6-bromo-2-oxo-2H-chromene-3-carboxylate

Description:
Ethyl 6-bromo-2-oxo-2H-chromene-3-carboxylate is a chemical compound characterized by its chromene structure, which features a fused benzene and pyran ring. This compound contains a bromo substituent at the 6-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylate group at the 3-position enhances its acidity and makes it a useful intermediate in various chemical reactions, including esterification and condensation reactions. The ethyl ester group provides solubility in organic solvents, facilitating its use in laboratory settings. Additionally, the keto group at the 2-position plays a crucial role in the compound's reactivity, allowing for further functionalization. Ethyl 6-bromo-2-oxo-2H-chromene-3-carboxylate is of interest in medicinal chemistry and materials science due to its potential biological activities and applications in the development of pharmaceuticals and agrochemicals. Its unique structural features make it a valuable compound for research and development in various chemical fields.
Formula:C12H9BrO4
InChI:InChI=1/C12H9BrO4/c1-2-16-11(14)9-6-7-5-8(13)3-4-10(7)17-12(9)15/h3-6H,2H2,1H3
InChI key:RXGDNKCWEKUYQA-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc2cc(ccc2oc1=O)Br
Synonyms:
  • 2H-1-Benzopyran-3-carboxylic acid, 6-bromo-2-oxo-, ethyl ester
  • 6-Bromo-2-oxo-2H-chromene-3-carboxylic acid ethyl ester
  • Ethyl 6-bromo-2-oxo-2H-chromene-3-carboxylate
Found 5 products.