CymitQuimica logo

CAS 21991-39-9

:

2H-Imidazo[4,5-b]pyridin-2-one, 1,3-dihydro-3-methyl-

Description:
2H-Imidazo[4,5-b]pyridin-2-one, 1,3-dihydro-3-methyl- (CAS 21991-39-9) is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a 2-oxo group at the 2-position of the imidazole ring and a methyl group at the 3-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of nitrogen atoms in the ring structure imparts basicity and potential for hydrogen bonding, making it a candidate for various biological activities. This compound may exhibit pharmacological properties, including antimicrobial or anti-inflammatory effects, which are common in similar heterocyclic compounds. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c1-10-6-5(9-7(10)11)3-2-4-8-6/h2-4H,1H3,(H,9,11)
InChI key:UNTZTFGDFVDERP-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC=N2)NC1=O
Found 4 products.