CAS 219949-89-0
:methyl8-fluoro-4-hydroxyquinoline-2-carboxylate
Description:
Methyl 8-fluoro-4-hydroxyquinoline-2-carboxylate is a chemical compound characterized by its quinoline structure, which includes a fluorine atom and a hydroxyl group. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or antitumor effects. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions and applications. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity or selectivity in biological systems. Additionally, the hydroxyl group may participate in hydrogen bonding, affecting the compound's interactions with other molecules. Overall, methyl 8-fluoro-4-hydroxyquinoline-2-carboxylate is of interest in medicinal chemistry and may serve as a lead compound for further development in pharmaceutical research. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.
Formula:C11H8FNO3
InChI:InChI=1S/C11H8FNO3/c1-16-11(15)8-5-9(14)6-3-2-4-7(12)10(6)13-8/h2-5H,1H3,(H,13,14)
InChI key:ZBYHIAANNKRIBZ-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=O)C2=C(N1)C(=CC=C2)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
