CymitQuimica logo

CAS 21997-30-8

:

1-Allyl-2(1H)-pyridinone

Description:
1-Allyl-2(1H)-pyridinone, with the CAS number 21997-30-8, is an organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone and an allyl group. This compound typically exhibits a pale yellow to amber color and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic nature. The presence of the allyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and as a building block in organic synthesis. Additionally, 1-Allyl-2(1H)-pyridinone may possess biological activity, which has been explored in various studies, indicating potential applications in pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, making it important to handle this compound with care in laboratory settings. Overall, 1-Allyl-2(1H)-pyridinone is a versatile compound with significant implications in both industrial and research contexts.
Formula:C8H9NO
InChI:InChI=1/C8H9NO/c1-2-6-9-7-4-3-5-8(9)10/h2-5,7H,1,6H2
InChI key:QXLAXTADFRGVIS-UHFFFAOYSA-N
SMILES:C=CCn1ccccc1=O
Synonyms:
  • 1-(prop-2-en-1-yl)pyridin-2(1H)-one
Found 2 products.