CymitQuimica logo

CAS 219988-95-1

:

(4-chlorophenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone

Description:
The chemical substance known as (4-chlorophenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone, with the CAS number 219988-95-1, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and a chlorophenyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential biological activity. The presence of the (E)-3-phenylprop-2-enyl group indicates that it has a specific geometric configuration, which can influence its interactions with biological targets. The chlorine atom on the phenyl ring may enhance lipophilicity and affect the compound's pharmacokinetic properties. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The specific arrangement of functional groups and the overall molecular architecture can lead to diverse biological activities, making it a subject of interest in research related to pharmacology and biochemistry.
Formula:C20H21ClN2O
InChI:InChI=1S/C20H21ClN2O/c21-19-10-8-18(9-11-19)20(24)23-15-13-22(14-16-23)12-4-7-17-5-2-1-3-6-17/h1-11H,12-16H2/b7-4+
InChI key:NKOTUQPBTKXMQO-QPJJXVBHSA-N
SMILES:C1CN(CCN1C/C=C/C2=CC=CC=C2)C(=O)C3=CC=C(C=C3)Cl
Synonyms:
  • (4-chlorophenyl)-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methanone
  • WAY-324571
  • Methanone, (4-chlorophenyl)[4-[(2E)-3-phenyl-2-propen-1-yl]-1-piperazinyl]-
  • 1-(4-Chlorobenzoyl)-4-[(2E)-3-phenylprop-2-en-1-yl]piperazine
Found 2 products.