CAS 2200861-77-2

2lambda6-thia-6-azaspiro[3.5]nonane-2,2-dione hydrochloride

Description:

2lambda6-thia-6-azaspiro[3.5]nonane-2,2-dione hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which incorporates both sulfur and nitrogen atoms within its framework. This compound features a thiazolidine-like ring system, contributing to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The spirocyclic nature of the compound may impart specific stereochemical properties, influencing its interaction with biological targets. Additionally, the diketone functionality suggests potential reactivity, allowing for further chemical modifications or interactions. As with many compounds in medicinal chemistry, understanding its pharmacokinetics, toxicity, and therapeutic potential would require comprehensive studies. Overall, 2lambda6-thia-6-azaspiro[3.5]nonane-2,2-dione hydrochloride represents a structurally intriguing molecule with possible implications in drug development and research.

Formula: C₇H₁₄ClNO₂S

InChI: InChI=1S/C7H13NO2S.ClH/c9-11(10)5-7(6-11)2-1-3-8-4-7;/h8H,1-6H2;1H

InChI key: OYRITEHMJMEIEA-UHFFFAOYSA-N

SMILES: C1CC2(CNC1)CS(=O)(=O)C2.Cl

Synonyms:

• 2-thia-6-azaspiro[3.5]nonane 2,2-dioxide hydrochloride
• 2lambda6-thia-6-azaspiro[3.5]nonane-2,2-dione
• hydrochloride

2-Thia-6-azaspiro[3.5]Nonane 2,2-dioxide hydrochloride

CAS: 2200861-77-2

2-Thia-6-azaspiro[3.5]Nonane 2,2-dioxide hydrochloride

Formula: C₇H₁₄ClNO₂S

Purity: 95%

Molecular weight: 211.71

Ref: 54-OR1038998

2-Thia-6-azaspiro[3.5]Nonane 2,2-dioxide hydrochloride

CAS: 2200861-77-2

Formula: C₇H₁₄ClNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 211.7096

Ref: IN-DA0223P2

2-thia-6-azaspiro[3.5]nonane 2,2-dioxide hydrochloride

CAS: 2200861-77-2

Purity: 95%

Molecular weight: 175.25

Ref: 10-F984586