CAS 220141-72-0: 3,4,5-Trifluorobenzyl bromide
Description:3,4,5-Trifluorobenzyl bromide is an organic compound characterized by the presence of a benzyl group substituted with three fluorine atoms at the 3, 4, and 5 positions, along with a bromine atom. This compound is typically a colorless to pale yellow liquid, exhibiting a distinct aromatic odor. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions, where the bromine atom can be replaced by various nucleophiles. The presence of fluorine atoms enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and material science. Additionally, 3,4,5-Trifluorobenzyl bromide is soluble in organic solvents, such as dichloromethane and acetone, but has limited solubility in water. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact. Overall, its unique properties make it a valuable intermediate in the synthesis of various fluorinated organic compounds.
Formula:C7H4BrF3
InChI:InChI=1S/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2
InChI key:InChIKey=MPEKZIYOLQCWLL-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1F)CBr
- Synonyms:
- 5-(Bromomethyl)-1,2,3-Trifluorobenzene
- Benzene, 5-(bromomethyl)-1,2,3-trifluoro-
- alpha-Bromo-3,4,5-trifluorotoluene
- 3,4,5-Trifluorobenzyl bromide
