CAS 220141-72-0
:3,4,5-Trifluorobenzyl bromide
Description:
3,4,5-Trifluorobenzyl bromide is an organic compound characterized by the presence of a benzyl group substituted with three fluorine atoms at the 3, 4, and 5 positions, along with a bromine atom. This compound is typically a colorless to pale yellow liquid, exhibiting a distinct aromatic odor. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions, where the bromine atom can be replaced by various nucleophiles. The presence of fluorine atoms enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and material science. Additionally, 3,4,5-Trifluorobenzyl bromide is soluble in organic solvents, such as dichloromethane and acetone, but has limited solubility in water. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact. Overall, its unique properties make it a valuable intermediate in the synthesis of various fluorinated organic compounds.
Formula:C7H4BrF3
InChI:InChI=1S/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2
InChI key:InChIKey=MPEKZIYOLQCWLL-UHFFFAOYSA-N
SMILES:C(Br)C1=CC(F)=C(F)C(F)=C1
Synonyms:- 5-(Bromomethyl)-1,2,3-Trifluorobenzene
- Benzene, 5-(bromomethyl)-1,2,3-trifluoro-
- alpha-Bromo-3,4,5-trifluorotoluene
- 3,4,5-Trifluorobenzyl bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,4,5-Trifluorobenzyl Bromide
CAS:Formula:C7H4BrF3Purity:>97.0%(GC)Color and Shape:Light yellow to Brown clear liquidMolecular weight:225.013,4,5-Trifluorobenzyl bromide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H4BrF3Purity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:225.015-(Bromomethyl)-1,2,3-trifluorobenzene
CAS:5-(Bromomethyl)-1,2,3-trifluorobenzeneFormula:C7H4BrF3Purity:98%Molecular weight:225.013,4,5-Trifluorobenzyl bromide
CAS:Formula:C7H4BrF3Purity:98%Color and Shape:LiquidMolecular weight:225.00593,4,5-Trifluorobenzyl bromide
CAS:3,4,5-Trifluorobenzyl bromideFormula:C7H4BrF3Purity:98%Color and Shape:Pale yellow LiquidMolecular weight:225.005863,4,5-Trifluorobenzyl bromide
CAS:Formula:C7H4BrF3Purity:97.0%Color and Shape:LiquidMolecular weight:225.008





