CymitQuimica logo

CAS 220185-63-7

:

Benzenamine, 4,5-dichloro-2-iodo-

Description:
Benzenamine, 4,5-dichloro-2-iodo- is an organic compound characterized by the presence of an amino group (-NH2) attached to a benzene ring that is further substituted with two chlorine atoms and one iodine atom. This compound belongs to the class of aromatic amines and is notable for its halogenated structure, which can influence its reactivity and physical properties. The presence of multiple halogen substituents typically enhances the compound's potential for electrophilic aromatic substitution reactions. Additionally, the iodine atom can serve as a leaving group in nucleophilic substitution reactions. The compound may exhibit varying solubility in organic solvents and water, depending on the balance of hydrophobic and hydrophilic characteristics imparted by the halogen substituents. Its applications may include use in organic synthesis, as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Safety considerations are important, as halogenated amines can pose health risks, necessitating proper handling and disposal protocols.
Formula:C6H4Cl2IN
InChI:InChI=1S/C6H4Cl2IN/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,10H2
InChI key:PLPUEJCYMXSRKW-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Cl)Cl)I)N
Found 4 products.