CymitQuimica logo

CAS 220191-36-6

:

3,4-bis(2,4,5-trimethylthiophen-3-yl)-1H-pyrrole-2,5-dione

Description:
3,4-bis(2,4,5-trimethylthiophen-3-yl)-1H-pyrrole-2,5-dione, with the CAS number 220191-36-6, is an organic compound characterized by its complex structure that includes a pyrrole ring and multiple thiophene substituents. This compound features two 2,4,5-trimethylthiophene groups attached to the pyrrole moiety, which contributes to its unique electronic properties and potential applications in organic electronics and materials science. The presence of the pyrrole-2,5-dione functional group suggests that it may exhibit interesting redox behavior, making it a candidate for use in organic semiconductors or as a dye. Additionally, the trimethyl groups on the thiophene rings can influence the solubility and stability of the compound. Its synthesis typically involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and UV-Vis spectroscopy. Overall, this compound represents a fascinating area of study in the field of organic chemistry, particularly in the development of novel materials with specific electronic properties.
Formula:C18H19NO2S2
InChI:InChI=1/C18H19NO2S2/c1-7-9(3)22-11(5)13(7)15-16(18(21)19-17(15)20)14-8(2)10(4)23-12(14)6/h1-6H3,(H,19,20,21)
InChI key:OHZCQTZIDIVCPI-UHFFFAOYSA-N
SMILES:Cc1c(C)sc(C)c1C1=C(c2c(C)c(C)sc2C)C(=O)N=C1O
Synonyms:
  • 1H-pyrrole-2,5-dione, 3,4-bis(2,4,5-trimethyl-3-thienyl)-
  • 3,4-Bis(2,4,5-trimethyl-3-thienyl)-1H-pyrrole-2,5-dione
Found 4 products.