CAS 220209-71-2

Formula: C21H28O3

InChI: InChI=1S/C21H28O3/c1-12(2)16-10-14-6-7-17-13(3)15(20(22)23)8-9-21(17,4)18(14)11-19(16)24-5/h10-12,17H,6-9H2,1-5H3,(H,22,23)/t17-,21-/m0/s1

InChI key: DJRFNRVSOMFEMZ-UWJYYQICSA-N

SMILES: CC1=C(CC[C@]2([C@H]1CCC3=CC(=C(C=C32)OC)C(C)C)C)C(=O)O

Triptohairic acid

CAS: 220209-71-2

Triptohairic acid is a useful organic compound for research related to life sciences and the catalog number is T125323.

Formula: C₂₁H₂₈O₃

Color and Shape: Solid

Molecular weight: 328.45

Ref: TM-T125323

Triptohairic acid

CAS: 220209-71-2

Triptohairic acid is a synthetic biochemical compound, which is developed through advanced organic synthesis methodologies. Its structure is inspired by natural derivatives found in certain botanical sources, but it is not naturally occurring. The mode of action of Triptohairic acid involves modulation of cellular signaling pathways related to hair follicle stimulation and neurogenic activity. It is believed to interact with receptor sites specific to keratinocyte and neuronal cells, promoting cellular proliferation and differentiation.

Formula: C₂₁H₂₈O₃

Purity: Min. 95%

Molecular weight: 328.40 g/mol

Ref: 3D-VIA20971