CymitQuimica logo

CAS 220227-66-7

:

Benzeneacetic acid, 2-fluoro-5-(trifluoromethyl)-

Description:
Benzeneacetic acid, 2-fluoro-5-(trifluoromethyl)-, identified by CAS number 220227-66-7, is an aromatic carboxylic acid characterized by the presence of a benzene ring substituted with a fluorine atom at the 2-position and a trifluoromethyl group at the 5-position. This compound exhibits typical properties of aromatic acids, including a relatively high boiling point and moderate solubility in polar solvents due to the carboxylic acid functional group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. As a fluorinated compound, it may exhibit unique chemical behaviors, such as increased stability and altered interaction with biological systems. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with fluorinated compounds. Overall, this compound represents a unique intersection of aromatic chemistry and fluorine chemistry, making it of interest in various scientific fields.
Formula:C9H6F4O2
InChI:InChI=1S/C9H6F4O2/c10-7-2-1-6(9(11,12)13)3-5(7)4-8(14)15/h1-3H,4H2,(H,14,15)
InChI key:OIVIPAUIJVTMGM-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)CC(=O)O)F
Synonyms:
  • 2-Fluoro-5-trifluoromethylphenylaceticacid
  • 2-[2-Fluoro-5-(trifluoromethyl)phenyl]acetic acid
  • 2-Fluoro-5-(trifluoromethyl)phenylaceticacid
  • 2-Fluoro-5-(trifluoromethyl)phenylacetic acid
Found 4 products.