CymitQuimica logo

CAS 220227-98-5

:

4-Hydroxy-3-(trifluoromethyl)benzaldehyde

Description:
4-Hydroxy-3-(trifluoromethyl)benzaldehyde, with the CAS number 220227-98-5, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a trifluoromethyl group (-CF3) attached to a benzaldehyde structure. This compound features a benzene ring with a formyl group (-CHO) and exhibits both aromatic and aldehyde properties. The trifluoromethyl group significantly influences its chemical reactivity and physical properties, often enhancing lipophilicity and altering the compound's electronic characteristics. The hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect solubility and reactivity in various chemical environments. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its unique functional groups that can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, its fluorinated nature may impart specific biological activities or enhance the stability of the resulting compounds in certain applications.
Formula:C8H5F3O2
InChI:InChI=1/C8H5F3O2/c9-8(10,11)6-3-5(4-12)1-2-7(6)13/h1-4,13H
InChI key:ZLMUFCNWTPSOSN-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C=O)C(F)(F)F)O
Synonyms:
  • 4-Hydroxy-a,a,a-trifluoro-m-tolualdehyde
  • Benzaldehyde, 4-hydroxy-3-(trifluoromethyl)-
  • Vhr Dq Cxfff [Wln]
Found 4 products.