CymitQuimica logo

CAS 220239-66-7

:

3-(Trifluoromethoxy)thiophenol

Description:
3-(Trifluoromethoxy)thiophenol is an organosulfur compound characterized by the presence of a thiophenol moiety substituted with a trifluoromethoxy group. This compound features a thiophene ring, which is a five-membered aromatic ring containing sulfur, and a hydroxyl group (-OH) attached to the aromatic carbon, making it a thiophenol derivative. The trifluoromethoxy group (-O-CF3) is a strong electron-withdrawing substituent, which can significantly influence the compound's reactivity and properties, such as its acidity and electrophilicity. The presence of fluorine atoms enhances the compound's lipophilicity and can affect its solubility in various solvents. Additionally, the trifluoromethoxy group may impart unique electronic properties, making this compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's molecular structure and substituents suggest potential uses in synthesis and as a building block in organic chemistry. Safety data and handling precautions should be considered due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C7H5F3OS
InChI:InChI=1S/C7H5F3OS/c8-7(9,10)11-5-2-1-3-6(12)4-5/h1-4,12H
InChI key:InChIKey=GEJGGOYNWFQKKH-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(S)=CC=C1
Synonyms:
  • 3-(Trifluoromethoxy)benzenethiol
  • 3-(Trifluoromethyloxy)thiophenol
  • Benzenethiol, 3-(trifluoromethoxy)-
Found 4 products.