CymitQuimica logo

CAS 2203-34-1

:

2-Butanol, 4-chloro-

Description:
2-Butanol, 4-chloro- is an organic compound characterized by the presence of a butanol backbone with a chlorine atom substituted at the fourth carbon position. This compound is a secondary alcohol, which means it has a hydroxyl (-OH) group attached to a carbon that is connected to two other carbon atoms. The presence of the chlorine atom introduces unique reactivity and properties, such as increased polarity and potential for nucleophilic substitution reactions. 2-Butanol, 4-chloro- is typically a colorless liquid at room temperature and may have a mild odor. It is soluble in water due to the hydroxyl group, but the chlorine substituent can affect its solubility and volatility. This compound is used in various chemical syntheses and may serve as an intermediate in the production of other chemicals. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled, and proper storage conditions should be observed to maintain its stability.
Formula:C4H9ClO
InChI:InChI=1S/C4H9ClO/c1-4(6)2-3-5/h4,6H,2-3H2,1H3
InChI key:AKMIPCJUTXDZKR-UHFFFAOYSA-N
SMILES:CC(CCCl)O
Found 3 products.