
CAS 220343-46-4
:1-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]cyclobutanemethanol
Description:
1-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]cyclobutanemethanol, with the CAS number 220343-46-4, is a chemical compound characterized by its unique structural features. It contains a cyclobutane ring, which contributes to its cyclic nature and potential strain effects. The presence of a dimethylsilyl group enhances its stability and solubility in organic solvents, while the tert-butyl group provides steric hindrance, influencing its reactivity and interactions with other molecules. The hydroxymethyl functional group suggests potential for hydrogen bonding, which can affect its physical properties such as boiling point and solubility in polar solvents. This compound may exhibit interesting chemical behavior due to the combination of its functional groups, making it a candidate for various applications in organic synthesis or as a building block in more complex chemical structures. Its specific reactivity and applications would depend on the context of its use in chemical reactions or material science.
Formula:C12H26O2Si
InChI:InChI=1S/C12H26O2Si/c1-11(2,3)15(4,5)14-10-12(9-13)7-6-8-12/h13H,6-10H2,1-5H3
InChI key:AONWRCHOMRHIOU-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCC1(CCC1)CO
Synonyms:- [1-(tert-Butyl-dimethyl-silanyloxymethyl)
- (1-(((TERT-BUTYLDIMETHYLSILYL)OXY)METHYL)CYCLOBUTYL)METHANOL
- -cyclobutyl]-methanol
- Cyclobutanemethanol, 1-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-
- 1-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]cyclobutanemethanol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]cyclobutanemethanol
CAS:Formula:C12H26O2SiColor and Shape:LiquidMolecular weight:230.4191
