CymitQuimica logo

CAS 22035-53-6

:

dimethyl isopropylidenemalonate

Description:
Dimethyl isopropylidenemalonate, with the CAS number 22035-53-6, is an organic compound characterized by its structure, which includes two ester groups and a malonate framework. It typically appears as a colorless to pale yellow liquid and is known for its pleasant odor. This compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Dimethyl isopropylidenemalonate is often utilized in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is attributed to the presence of the malonate moiety, which can undergo various chemical transformations, including condensation and substitution reactions. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety precautions during handling. Overall, dimethyl isopropylidenemalonate is a versatile compound with significant applications in synthetic organic chemistry.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-5(2)6(7(9)11-3)8(10)12-4/h1-4H3
InChI key:QJASGQYZCPDCJR-UHFFFAOYSA-N
SMILES:CC(=C(C(=O)OC)C(=O)OC)C
Found 2 products.