CymitQuimica logo

CAS 220394-91-2

:

Benzyl-4-isocyanatotetrahydro-1(2H)-pyridinecarboxylate

Description:
Benzyl-4-isocyanatotetrahydro-1(2H)-pyridinecarboxylate is a chemical compound characterized by its isocyanate functional group, which is known for its reactivity and ability to form ureas and carbamates. This compound features a tetrahydro-pyridine ring, contributing to its cyclic structure and potential for various chemical interactions. The presence of the benzyl group enhances its lipophilicity, which may influence its solubility in organic solvents. The isocyanate group is particularly significant in synthetic chemistry, as it can participate in nucleophilic addition reactions with amines and alcohols, making it useful in the synthesis of diverse organic compounds. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Its CAS number, 220394-91-2, allows for easy identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and materials science. Proper handling and safety precautions are essential due to the potential toxicity associated with isocyanates.
Formula:C14H16N2O3
InChI:InChI=1/C14H16N2O3/c17-11-15-13-6-8-16(9-7-13)14(18)19-10-12-4-2-1-3-5-12/h1-5,13H,6-10H2
InChI key:JBQXPARAPVCGFW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COC(=O)N1CCC(CC1)N=C=O
Synonyms:
  • 1-Piperidinecarboxylic Acid, 4-Isocyanato-, Phenylmethyl Ester
  • Benzyl 4-isocyanatopiperidine-1-carboxylate
Found 2 products.