CymitQuimica logo

CAS 22047-86-5

:

4,6-Dimethyl-3-pyridinecarboxylic acid

Description:
4,6-Dimethyl-3-pyridinecarboxylic acid, with the CAS number 22047-86-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two methyl groups at the 4 and 6 positions and a carboxylic acid functional group at the 3 position, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a building block in organic synthesis. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and purity. As with many pyridine derivatives, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c1-5-3-6(2)9-4-7(5)8(10)11/h3-4H,1-2H3,(H,10,11)
InChI key:DNXREYUMWKSTJU-UHFFFAOYSA-N
SMILES:Cc1cc(C)ncc1C(=O)O
Synonyms:
  • 4,6-Dimethylpyridine-3-Carboxylic Acid
Found 4 products.