CymitQuimica logo

CAS 22048-71-1

:

[4-(1H-pyrrol-1-yl)phenyl]acetic acid

Description:
[4-(1H-pyrrol-1-yl)phenyl]acetic acid, with the CAS number 22048-71-1, is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with a pyrrole group and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential interactions with biological systems due to its ability to form hydrogen bonds. The presence of the pyrrole ring may impart certain biological activities, making it of interest in medicinal chemistry. Additionally, the carboxylic acid functional group contributes to its acidity and reactivity, allowing for potential derivatization and participation in various chemical reactions. The compound's molecular structure suggests it may engage in π-π stacking interactions and could be involved in various applications, including pharmaceuticals and agrochemicals. Overall, [4-(1H-pyrrol-1-yl)phenyl]acetic acid is a versatile compound with potential implications in both research and industry.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c14-12(15)9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H,9H2,(H,14,15)
InChI key:KCZGWRZYJZGMQW-UHFFFAOYSA-N
SMILES:c1ccn(c1)c1ccc(cc1)CC(=O)O
Synonyms:
  • benzeneacetic acid, 4-(1H-pyrrol-1-yl)-
Found 4 products.