CymitQuimica logo

CAS 220493-61-8

:

7-oxo-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:
7-Oxo-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential solubility in polar solvents. The presence of the 7-oxo group indicates a carbonyl functionality that can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The triazole ring, known for its stability and ability to form coordination complexes, enhances the compound's biological activity, making it of interest in medicinal chemistry. Its structural complexity allows for diverse interactions with biological targets, potentially leading to applications in pharmaceuticals. Additionally, the compound's molecular weight and specific stereochemistry can influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Overall, 7-oxo-1,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid represents a significant class of compounds with potential therapeutic applications.
Formula:C6H4N4O3
InChI:InChI=1/C6H4N4O3/c11-4-3(5(12)13)1-7-6-8-2-9-10(4)6/h1-2H,(H,12,13)(H,7,8,9)
InChI key:BVJYXVOQPBYXDV-UHFFFAOYSA-N
SMILES:c1c(c(=O)n2c(n1)nc[nH]2)C(=O)O
Found 6 products.