CAS 2205018-06-8

(3E,5R,6S,9E,11S,14S)-5,11-Dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione

Description:

The chemical substance with the name "(3E,5R,6S,9E,11S,14S)-5,11-Dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione" and CAS number "2205018-06-8" is characterized by its complex molecular structure, which includes multiple stereocenters and functional groups. This compound features a dioxacyclotetradecane framework, indicating the presence of two ether linkages within a 14-membered ring system. The presence of hydroxyl groups at the 5 and 11 positions suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The double bonds at the 3 and 9 positions contribute to its unsaturation, affecting its chemical behavior and stability. Additionally, the specific stereochemistry (denoted by the E and S configurations) plays a crucial role in determining the compound's biological activity and interactions with other molecules. Overall, this substance may exhibit unique properties that could be of interest in fields such as medicinal chemistry or materials science, although further studies would be necessary to fully elucidate its characteristics and potential applications.

Formula: C₁₄H₂₀O₆

InChI: InChI=1S/C14H20O6/c1-9-3-4-11(15)5-7-14(18)20-10(2)12(16)6-8-13(17)19-9/h5-12,15-16H,3-4H2,1-2H3/b7-5+,8-6+/t9-,10-,11-,12+/m0/s1

InChI key: InChIKey=SSVNIYICRYPPEB-AATSMRKUSA-N

SMILES: C[C@H]1[C@H](O)/C=C/C(=O)O[C@@H](C)CC[C@H](O)\C=C\C(=O)O1

Synonyms:

• 13-epi-Cordybislactone
• Clonostachydiol
• (3E,5R,6S,9E,11S,14S)-5,11-Dihydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,8-dione
• 1,7-Dioxacyclotetradeca-3,9-diene-2,8-dione, 5,11-dihydroxy-6,14-dimethyl-, (3E,5R,6S,9E,11S,14S)-

Clonostachydiol

CAS: 2205018-06-8

Clonostachydiol is a bioactive compound, which is derived from the secondary metabolites of the Clonostachys genus, a type of fungi. This natural product functions primarily through its antifungal mode of action, disrupting the cellular integrity of pathogenic fungi and inhibiting their growth. The antifungal mechanism is linked to interference with cell wall synthesis and membrane integrity, making it an effective agent against a range of fungal species.

Formula: C₁₄H₂₀O₆

Purity: Min. 95%

Molecular weight: 284.30 g/mol

Ref: 3D-FND01806