CymitQuimica logo

CAS 220504-75-6

:

2,4-dimethyl-5-nitrobenzoic acid

Description:
2,4-Dimethyl-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by its nitro and methyl substituents on the benzene ring. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to donate protons in solution. The nitro group (-NO2) is an electron-withdrawing group, which can influence the reactivity and acidity of the compound, while the methyl groups (-CH3) serve as electron-donating groups, affecting the overall electronic distribution. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. Its molecular structure contributes to its potential applications in organic synthesis, pharmaceuticals, and as an intermediate in the production of dyes or agrochemicals. Additionally, the compound's unique combination of functional groups may impart specific reactivity patterns, making it of interest in various chemical reactions and studies. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C9H9NO4
InChI:InChI=1/C9H9NO4/c1-5-3-6(2)8(10(13)14)4-7(5)9(11)12/h3-4H,1-2H3,(H,11,12)
InChI key:OVWSQNZKIRGLMK-UHFFFAOYSA-N
SMILES:Cc1cc(C)c(cc1C(=O)O)N(=O)=O
Synonyms:
  • Benzoic Acid, 2,4-Dimethyl-5-Nitro-
Found 5 products.