CAS 220634-33-3
:7-methoxy-2,2-dimethyl-3,4-dihydro-2H-chromen-4-amine
Description:
7-Methoxy-2,2-dimethyl-3,4-dihydro-2H-chromen-4-amine, with the CAS number 220634-33-3, is a chemical compound that belongs to the class of chromenes, which are bicyclic compounds featuring a benzene ring fused to a pyran ring. This particular compound is characterized by the presence of a methoxy group (-OCH3) at the 7-position and an amine group (-NH2) at the 4-position of the chromene structure. The two methyl groups at the 2-position contribute to its dimethyl substitution, influencing its steric and electronic properties. The dihydro form indicates that the compound has a saturated pyran ring, which can affect its reactivity and stability. This compound may exhibit biological activity, potentially serving as a lead structure in medicinal chemistry, particularly in the development of pharmaceuticals. Its unique structural features may also impart specific solubility and interaction characteristics, making it of interest in various chemical and biological applications.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-12(2)7-10(13)9-5-4-8(14-3)6-11(9)15-12/h4-6,10H,7,13H2,1-3H3
InChI key:ILVYMPMYKKRSPO-UHFFFAOYSA-N
SMILES:CC1(C)CC(c2ccc(cc2O1)OC)N
Synonyms:- 2H-1-benzopyran-4-amine, 3,4-dihydro-7-methoxy-2,2-dimethyl-
- 7-Methoxy-2,2-dimethylchroman-4-amine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(7-methoxy-2,2-dimethyl-3,4-dihydro-2H-chromen-4-yl)amine
CAS:Formula:C12H17NO2Molecular weight:207.2689
