CymitQuimica logo

CAS 220769-83-5

:

2-Pyrimidinecarbonylchloride

Description:
2-Pyrimidinecarbonyl chloride, also known as 2-pyrimidinoyl chloride, is an organic compound characterized by the presence of a pyrimidine ring substituted with a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly as an acylating agent in organic synthesis, where it can introduce the pyrimidinecarbonyl moiety into various substrates. The presence of the carbonyl chloride group makes it a potent electrophile, allowing it to readily react with nucleophiles such as amines and alcohols. Additionally, 2-pyrimidinecarbonyl chloride is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of the corresponding carboxylic acid. Its applications extend to the synthesis of pharmaceuticals and agrochemicals, where it serves as an important intermediate in the development of biologically active compounds. Proper safety precautions should be taken when handling this compound due to its corrosive nature and potential health hazards.
Formula:C5H3ClN2O
InChI:InChI=1S/C5H3ClN2O/c6-4(9)5-7-2-1-3-8-5/h1-3H
InChI key:FOVRZAGACROHCK-UHFFFAOYSA-N
SMILES:C1=CN=C(N=C1)C(=O)Cl
Synonyms:
  • 2-Pyrimidinecarbonyl chloride (9CI)
Found 3 products.