CymitQuimica logo

CAS 220780-57-4

:

3-Bromo-1,2-oxazole-5-carbaldehyde

Description:
3-Bromo-1,2-oxazole-5-carbaldehyde is a heterocyclic organic compound characterized by the presence of both a bromine atom and an aldehyde functional group within its oxazole ring structure. The oxazole ring consists of a five-membered aromatic system containing both nitrogen and oxygen, which contributes to its unique chemical reactivity and properties. The bromine substituent enhances the compound's electrophilic character, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The aldehyde group allows for further functionalization, enabling the compound to participate in reactions such as nucleophilic addition and condensation. This compound is typically used as an intermediate in the synthesis of more complex molecules and may exhibit biological activity, although specific biological properties would depend on the context of its use. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C4H2BrNO2
InChI:InChI=1/C4H2BrNO2/c5-4-1-3(2-7)8-6-4/h1-2H
InChI key:RXGNLDFDLLMAJZ-UHFFFAOYSA-N
SMILES:c1c(C=O)onc1Br
Synonyms:
  • 5-Isoxazolecarboxaldehyde, 3-Bromo-
  • 3-bromoisoxazole-5-carbaldehyde
Found 4 products.