CymitQuimica logo

CAS 220954-15-4

:

4-(3-Fluoro-5-nitrophenyl)morpholine

Description:
4-(3-Fluoro-5-nitrophenyl)morpholine, with the CAS number 220954-15-4, is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound features a phenyl group substituted with both a fluorine atom and a nitro group, contributing to its unique chemical properties. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the nitro group can serve as a potential site for further chemical reactions or modifications. Morpholine derivatives are often studied for their applications in pharmaceuticals and agrochemicals due to their ability to interact with biological systems. The compound's molecular structure suggests it may exhibit interesting electronic properties and reactivity, making it a candidate for various synthetic applications. Additionally, its specific functional groups may impart distinct characteristics such as solubility and stability under different conditions, which are crucial for its potential uses in research and industry.
Formula:C10H11FN2O3
InChI:InChI=1S/C10H11FN2O3/c11-8-5-9(7-10(6-8)13(14)15)12-1-3-16-4-2-12/h5-7H,1-4H2
InChI key:InChIKey=VPWVCQWWHPZJOA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=C(F)C1)N2CCOCC2
Synonyms:
  • 4-(3-Fluoro-5-nitrophenyl)morpholine
  • Morpholine, 4-(3-fluoro-5-nitrophenyl)-
Found 1 products.