CymitQuimica logo

CAS 2210-75-5

:

Oxirane, [(3-methoxyphenoxy)methyl]-

Description:
Oxirane, [(3-methoxyphenoxy)methyl]- is a chemical compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This structure imparts unique reactivity, making it useful in various chemical reactions, particularly in polymer synthesis and as an intermediate in organic synthesis. The presence of the 3-methoxyphenoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. Typically, compounds like this exhibit moderate to low toxicity, but specific safety data should be consulted for handling and usage guidelines. Additionally, the compound may participate in nucleophilic ring-opening reactions due to the strained nature of the oxirane ring, allowing for the introduction of various functional groups. Its applications can span across fields such as pharmaceuticals, agrochemicals, and materials science, where it may serve as a building block for more complex molecules. As with any chemical substance, proper safety measures and handling protocols should be observed to mitigate any potential hazards.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-11-8-3-2-4-9(5-8)12-6-10-7-13-10/h2-5,10H,6-7H2,1H3
InChI key:UCGYCLBMTBEQQM-UHFFFAOYSA-N
SMILES:COC1=CC(=CC=C1)OCC2CO2
Found 4 products.