CymitQuimica logo

CAS 221024-31-3

:

5-Bromo-7-chloro-2,3-dihydro-1H-indole

Description:
5-Bromo-7-chloro-2,3-dihydro-1H-indole is a heterocyclic organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine and chlorine substituents at the 5 and 7 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic nature of the indole ring. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-rich indole system. Additionally, the presence of halogen atoms can influence its biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure allows for potential interactions with biological targets, which could lead to pharmacological applications. As with many halogenated compounds, safety precautions should be taken when handling it due to potential toxicity and environmental concerns.
Formula:C8H7BrClN
InChI:InChI=1S/C8H7BrClN/c9-6-3-5-1-2-11-8(5)7(10)4-6/h3-4,11H,1-2H2
InChI key:InChIKey=MVNYXXSOOZHUAR-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(Br)=C1)CCN2
Synonyms:
  • 5-Bromo-7-chloro-2,3-dihydro-1H-indole
  • 1H-Indole, 5-bromo-7-chloro-2,3-dihydro-
  • 5-Bromo-7-chloroindoline
Found 3 products.