CymitQuimica logo

CAS 221024-42-6

:

Hydrazine, (1-ethylpropyl)-, monohydrochloride

Description:
Hydrazine, (1-ethylpropyl)-, monohydrochloride, also known by its CAS number 221024-42-6, is a chemical compound that belongs to the class of hydrazines, which are characterized by the presence of a hydrazine functional group (N2H4). This specific compound is a hydrochloride salt, indicating that it is formed by the reaction of hydrazine with hydrochloric acid. It typically appears as a white crystalline solid and is soluble in water, which is a common trait for many hydrazine derivatives. The compound is known for its potential applications in various fields, including pharmaceuticals and as a reducing agent in chemical reactions. However, hydrazines are generally regarded as hazardous materials due to their toxicity and potential for causing adverse health effects upon exposure. Therefore, handling this compound requires appropriate safety precautions, including the use of personal protective equipment and adherence to regulatory guidelines. Its reactivity and properties make it a subject of interest in both industrial and research settings.
Formula:C5H14N2ClH
InChI:InChI=1S/C5H14N2.ClH/c1-3-5(4-2)7-6;/h5,7H,3-4,6H2,1-2H3;1H
InChI key:CJFLBOKQFSMRMF-UHFFFAOYSA-N
SMILES:CCC(CC)NN.Cl
Found 5 products.