CymitQuimica logo

CAS 221030-92-8

:

4-Bromo-2-ethenyl-1-fluorobenzene

Description:
4-Bromo-2-ethenyl-1-fluorobenzene, with the CAS number 221030-92-8, is an organic compound that belongs to the class of halogenated aromatic hydrocarbons. It features a benzene ring substituted with a bromine atom, a fluorine atom, and an ethenyl group (vinyl group), which contributes to its reactivity and potential applications in organic synthesis. The presence of both bromine and fluorine atoms enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. This compound is typically characterized by its distinct physical properties, such as boiling and melting points, which are influenced by the halogen substituents and the ethenyl group. Additionally, it may exhibit unique spectral characteristics in techniques such as NMR and IR spectroscopy due to the presence of the halogens and the unsaturation in the ethenyl group. Its applications may extend to materials science, pharmaceuticals, and agrochemicals, where halogenated compounds often play crucial roles in enhancing biological activity or modifying material properties.
Formula:C8H6BrF
InChI:InChI=1S/C8H6BrF/c1-2-6-5-7(9)3-4-8(6)10/h2-5H,1H2
InChI key:InChIKey=PUVIIPMVFZISRW-UHFFFAOYSA-N
SMILES:C(=C)C1=C(F)C=CC(Br)=C1
Synonyms:
  • Benzene, 4-bromo-2-ethenyl-1-fluoro-
  • 1-(5-Bromo-2-fluorophenyl)ethene
  • 4-Bromo-1-fluoro-2-vinylbenzene
  • 4-Bromo-2-ethenyl-1-fluorobenzene
Found 2 products.