CymitQuimica logo

CAS 221050-88-0

:

tert-butyl 4-(2-chloropyrimidin-4-yl)piperazine-1-carboxylate

Description:
Tert-butyl 4-(2-chloropyrimidin-4-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, a pyrimidine moiety, and a tert-butyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many piperazine derivatives. The presence of the chloropyrimidine group may impart specific biological activities, making it of interest in medicinal chemistry and pharmaceutical research. The tert-butyl ester contributes to the compound's stability and can influence its lipophilicity, affecting its pharmacokinetic properties. Additionally, the compound may exhibit various reactivity patterns due to the functional groups present, allowing for potential modifications in synthetic applications. Overall, tert-butyl 4-(2-chloropyrimidin-4-yl)piperazine-1-carboxylate represents a versatile scaffold for further chemical exploration and development in drug discovery.
Formula:C13H19ClN4O2
InChI:InChI=1/C13H19ClN4O2/c1-13(2,3)20-12(19)18-8-6-17(7-9-18)10-4-5-15-11(14)16-10/h4-5H,6-9H2,1-3H3
InChI key:GZYDEJABHMSOIM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)c1ccnc(Cl)n1
Found 4 products.