CymitQuimica logo

CAS 22122-36-7

:

3-methylfuran-2(5H)-one

Description:
3-Methylfuran-2(5H)-one, also known as 3-methyl-2(5H)-furanone, is an organic compound characterized by its furan ring structure with a methyl group and a carbonyl functional group. It is a colorless to pale yellow liquid with a distinctive sweet, caramel-like aroma, making it of interest in the flavor and fragrance industry. The compound is soluble in organic solvents and exhibits moderate volatility. Its molecular structure contributes to its reactivity, particularly in condensation and oxidation reactions. 3-Methylfuran-2(5H)-one is often studied for its potential applications in food flavoring and as a synthetic intermediate in organic chemistry. Additionally, it may exhibit biological activity, although specific pharmacological properties require further investigation. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested in significant quantities. Overall, 3-methylfuran-2(5H)-one is a compound of interest due to its sensory properties and potential utility in various chemical applications.
Formula:C5H6O2
InChI:InChI=1/C5H6O2/c1-4-2-3-7-5(4)6/h2H,3H2,1H3
InChI key:VGHBEMPMIVEGJP-UHFFFAOYSA-N
SMILES:CC1=CCOC1=O
Synonyms:
  • 2(5H)-furanone, 3-methyl-
Found 6 products.