CymitQuimica logo

CAS 221285-25-2

:

(2-amino-6-fluorophenyl)methanol

Description:
(2-amino-6-fluorophenyl)methanol is an organic compound characterized by the presence of an amino group and a hydroxymethyl group attached to a fluorinated phenyl ring. The structure features a fluorine atom at the 6-position of the phenyl ring and an amino group at the 2-position, which contributes to its potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the hydroxymethyl group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the presence of both amino and hydroxymethyl functionalities can enhance interactions with biological targets. Additionally, the fluorine atom may influence the compound's lipophilicity and metabolic stability. Safety and handling precautions should be observed, as with any chemical substance, and its properties should be evaluated in the context of specific applications or research studies.
Formula:C7H8FNO
InChI:InChI=1/C7H8FNO/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4,9H2
InChI key:PHBLZACTWWFAER-UHFFFAOYSA-N
SMILES:c1cc(c(CO)c(c1)N)F
Found 4 products.