CymitQuimica logo

CAS 221290-14-8

:

[3-(tert-butylsulfamoyl)phenyl]boronic acid

Description:
[3-(tert-butylsulfamoyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a tert-butylsulfamoyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The tert-butylsulfamoyl group enhances its solubility and stability in organic solvents, while also potentially influencing its biological activity. The compound may participate in Suzuki coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, due to the presence of the sulfonamide moiety, it may exhibit specific interactions with biological targets, making it of interest in drug development. Overall, [3-(tert-butylsulfamoyl)phenyl]boronic acid is a versatile compound with applications in both synthetic and pharmaceutical chemistry.
Formula:C10H16BNO4S
InChI:InChI=1/C10H16BNO4S/c1-10(2,3)12-17(15,16)9-6-4-5-8(7-9)11(13)14/h4-7,12-14H,1-3H3
InChI key:LSSASZPAKWQFHO-UHFFFAOYSA-N
SMILES:CC(C)(C)NS(=O)(=O)c1cccc(c1)B(O)O
Found 4 products.