CAS 2213-81-2
:2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene
Description:
2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene, with the CAS number 2213-81-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two nitro groups and a chlorine atom. The presence of the 1,1-dimethylethyl group, also known as a tert-butyl group, contributes to its hydrophobic nature and steric bulk. This compound is typically a yellow to orange solid at room temperature and is known for its stability under normal conditions. However, it may pose environmental and health risks due to the presence of nitro groups, which can be explosive under certain conditions. The chlorine atom enhances its reactivity and potential for substitution reactions. 2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene is primarily used in research and industrial applications, particularly in the synthesis of other chemical compounds. Proper handling and safety measures are essential due to its potential toxicity and environmental impact.
Formula:C10H11ClN2O4
InChI:InChI=1S/C10H11ClN2O4/c1-10(2,3)6-4-7(12(14)15)9(11)8(5-6)13(16)17/h4-5H,1-3H3
InChI key:InChIKey=FRFMLDNFLXIDSH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Cl)C(N(=O)=O)=CC(C(C)(C)C)=C1
Synonyms:- 2,6-Dinitro-4-tert-butylchlorobenzene
- 2-Chloro-5-(1,1-Dimethylethyl)-1,3-Dinitrobenzene
- 5-Tert-Butyl-2-Chloro-1,3-Dinitrobenzene
- Benzene, 2-chloro-5-(1,1-dimethylethyl)-1,3-dinitro-
- Benzene, 5-tert-butyl-2-chloro-1,3-dinitro-
- 4-tert-Butyl-2,6-dinitrochlorobenzene
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene
CAS:Controlled ProductApplications 2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene (CAS# 2213-81-2) is a useful research chemical compound.
Formula:C10H11ClN2O4Color and Shape:NeatMolecular weight:258.658
