CymitQuimica logo

CAS 22132-98-5

:

S-Methyl-S-(3-methylphenyl)sulfoximine

Description:
S-Methyl-S-(3-methylphenyl)sulfoximine is an organic compound characterized by the presence of a sulfoximine functional group, which consists of a sulfur atom bonded to both an oxygen atom and a nitrogen atom, with the nitrogen further bonded to a methyl group and a 3-methylphenyl group. This compound typically exhibits properties associated with sulfoximines, such as potential biological activity and the ability to act as a nucleophile or electrophile in various chemical reactions. The presence of the 3-methylphenyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the methyl substituent on the sulfur atom can affect the steric and electronic properties of the molecule, potentially enhancing its reactivity in synthetic applications. S-Methyl-S-(3-methylphenyl)sulfoximine may be of interest in medicinal chemistry and agrochemical research due to its unique structural features and potential applications in drug development or as a pesticide. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C8H11NOS
InChI:InChI=1S/C8H11NOS/c1-7-4-3-5-8(6-7)11(2,9)10/h3-6,9H,1-2H3
InChI key:InChIKey=QTXLWZLMRDOCNA-UHFFFAOYSA-N
SMILES:S(C)(=N)(=O)C1=CC(C)=CC=C1
Synonyms:
  • Sulfoximine, S-methyl-S-(3-methylphenyl)-
  • Imino(methyl)(3-methylphenyl)-λ6-sulfanone
  • S-Methyl-S-(3-methylphenyl)sulfoximine
  • Sulfoximine, S-methyl-S-m-tolyl-
Found 4 products.