CAS 22136-74-9
:8-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one
Description:
The chemical substance known as "8-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one," with the CAS number 22136-74-9, is a flavonoid derivative characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, making it of interest in various biological and pharmacological studies. The presence of chromenone moieties indicates that it may exhibit a range of biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. Additionally, the methoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological systems. Overall, this compound represents a significant area of interest in natural product chemistry and medicinal research due to its diverse functional groups and potential health benefits.
Formula:C31H20O10
InChI:InChI=1/C31H20O10/c1-39-17-5-2-14(3-6-17)25-13-24(38)30-22(36)11-21(35)28(31(30)41-25)18-8-15(4-7-19(18)33)26-12-23(37)29-20(34)9-16(32)10-27(29)40-26/h2-13,32-36H,1H3
SMILES:COc1ccc(cc1)c1cc(=O)c2c(cc(c(c3cc(ccc3O)c3cc(=O)c4c(cc(cc4o3)O)O)c2o1)O)O
Synonyms:- 4H-1-Benzopyran-4-one, 8-(5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl)-5,7-dihydroxy-2-(4-methoxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Podocarpusflavone A
CAS:Formula:C31H20O10Purity:95%~99%Color and Shape:Yellow powderMolecular weight:552.491Podocarpusflavone A
CAS:Podocarpusflavone A is a DNA topoisomerase I inhibitor. It has moderated anti-proliferative activity induce cell apoptosis in MCF-7.Formula:C31H20O10Purity:99.26% - 99.897%Color and Shape:SolidMolecular weight:552.48Podocarpusflavone A
CAS:Podocarpusflavone A is a flavonoid compound, which is a type of polyphenolic molecule. It is isolated from the Podocarpus genus, a source known for yielding bioactive phytochemicals. The mode of action of Podocarpusflavone A involves modulation of various cellular signaling pathways, including antioxidative and anti-inflammatory mechanisms, which can influence cell proliferation and apoptosis.
Formula:C31H20O10Purity:Min. 95%Color and Shape:PowderMolecular weight:552.48 g/mol





