CymitQuimica logo

CAS 2217-65-4

:

Benzene, 1,1'-oxybis[2-nitro-

Description:
Benzene, 1,1'-oxybis[2-nitro-] (CAS number 2217-65-4) is an organic compound characterized by its structure, which features a benzene ring with two nitro groups and an ether linkage. The presence of the nitro groups, which are electron-withdrawing, significantly influences the compound's reactivity and properties. This substance is typically a yellow to brown solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. It is important to note that compounds containing nitro groups can exhibit explosive properties under certain conditions, making safety precautions essential when handling them. Additionally, the compound may be toxic and harmful if ingested or inhaled, necessitating proper safety measures in laboratory settings. Its solubility in organic solvents and limited solubility in water are typical for nitro-substituted aromatic compounds, affecting its behavior in various chemical environments.
Formula:C12H8N2O5
InChI:InChI=1S/C12H8N2O5/c15-13(16)9-5-1-3-7-11(9)19-12-8-4-2-6-10(12)14(17)18/h1-8H
InChI key:XVIRIXVOLLJIPF-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC=CC=C2[N+](=O)[O-]
Found 4 products.