CymitQuimica logo

CAS 222046-90-4

:

2-Thiophenecarboxylicacid, tetrahydro-5-oxo-

Description:
2-Thiophenecarboxylic acid, tetrahydro-5-oxo- is a chemical compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the tetrahydro-5-oxo moiety indicates that the compound has a saturated ring system with a carbonyl group, which can influence its chemical behavior and potential applications. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical chemistry. The molecular structure allows for various functional group interactions, which can be exploited in synthetic chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on the presence of the thiophene and carboxylic acid groups, affecting its use in different chemical reactions or as a precursor in organic synthesis. Overall, 2-Thiophenecarboxylic acid, tetrahydro-5-oxo- represents a unique class of compounds with potential utility in various chemical and medicinal applications.
Formula:C5H6O3S
InChI:InChI=1S/C5H6O3S/c6-4-2-1-3(9-4)5(7)8/h3H,1-2H2,(H,7,8)
InChI key:PYSNMSYPRJCMOU-UHFFFAOYSA-N
SMILES:C1CC(=O)SC1C(=O)O
Synonyms:
  • 2-Thiophenecarboxylicacid,tetrahydro-5-oxo-(9CI)
Found 3 products.