CAS 22212-26-6

1,2,9,10-tetramethoxy-6-methyl-5,6-dihydro-4H-dibenzo[de,g]quinoline

Description:

1,2,9,10-Tetramethoxy-6-methyl-5,6-dihydro-4H-dibenzo[de,g]quinoline is a complex organic compound characterized by its unique molecular structure, which includes a dibenzoquinoline framework. This compound features four methoxy (-OCH3) groups and a methyl (-CH3) group, contributing to its chemical reactivity and solubility properties. The presence of multiple methoxy groups typically enhances the compound's electron-donating ability, which can influence its interactions in various chemical environments. The dihydro form indicates that it has a saturated portion in its structure, which may affect its stability and reactivity compared to fully unsaturated analogs. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions under which it is studied. Overall, 1,2,9,10-tetramethoxy-6-methyl-5,6-dihydro-4H-dibenzo[de,g]quinoline represents a fascinating example of a polycyclic aromatic compound with potential applications in various fields.

Formula: C₂₁H₂₃NO₄

InChI: InChI=1/C21H23NO4/c1-22-7-6-12-9-18(25-4)21(26-5)20-14-11-17(24-3)16(23-2)10-13(14)8-15(22)19(12)20/h8-11H,6-7H2,1-5H3

SMILES: CN1CCc2cc(c(c3c4cc(c(cc4cc1c23)OC)OC)OC)OC

Dehydroglaucine

CAS: 22212-26-6

Dehydroglaucine inhibits acetylcholinesterase and fights S. aureus, M. smegmatis, C. albicans, A. niger.

Formula: C₂₁H₂₃NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 353.41

Ref: TM-TN1561

Dehydroglaucine

CAS: 22212-26-6

Dehydroglaucine is an alkaloid derivative, which is a naturally occurring compound sourced primarily from certain plant species within the Papaveraceae family. Dehydroglaucine is known for its unique chemical structure and potential pharmacological effects. The mode of action of dehydroglaucine involves its interaction with molecular targets within biological systems, which can modulate various cellular pathways and physiological functions.

Formula: C₂₁H₂₃NO₄

Purity: Min. 95%

Molecular weight: 353.4 g/mol

Ref: 3D-XAA21226