
CAS 2222067-12-9
:Pentanoic acid, 5-[[(1S)-2-[(acetyloxy)methoxy]-1-methyl-2-oxoethyl]amino]-5-oxo-, methyl ester
Description:
Pentanoic acid, 5-[[[1S]-2-[(acetyloxy)methoxy]-1-methyl-2-oxoethyl]amino]-5-oxo-, methyl ester, identified by CAS number 2222067-12-9, is a complex organic compound characterized by its ester functional group and a pentanoic acid backbone. This substance features a methyl ester group, which enhances its solubility in organic solvents and may influence its reactivity. The presence of an acetyloxy and methoxy group suggests potential for various chemical interactions, making it a candidate for applications in pharmaceuticals or as a biochemical probe. The compound's structure indicates it may exhibit specific stereochemistry due to the presence of a chiral center, which can affect its biological activity and interactions. Additionally, the oxo groups imply potential for reactivity in condensation or addition reactions. Overall, this compound's unique functional groups and structural features contribute to its potential utility in synthetic chemistry and medicinal applications.
Formula:C12H19NO7
InChI:InChI=1S/C12H19NO7/c1-8(12(17)20-7-19-9(2)14)13-10(15)5-4-6-11(16)18-3/h8H,4-7H2,1-3H3,(H,13,15)/t8-/m0/s1
InChI key:GYBSTWDRGMHMOZ-QMMMGPOBSA-N
SMILES:C[C@@H](C(=O)OCOC(=O)C)NC(=O)CCCC(=O)OC
Synonyms:- Pentanoic acid, 5-[[(1S)-2-[(acetyloxy)methoxy]-1-methyl-2-oxoethyl]amino]-5-oxo-, methyl ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pro-GA
CAS:Pro-GA is a cell-permeable γ-glutamylcyclotransferase (γ-GGCT) inhibitor that inhibit proliferation in multiple bladder cancer cell lines. antitumour.Formula:C12H19NO7Color and Shape:Transparent LiquidMolecular weight:289.28
