CAS 22230-82-6

methyl-D3 sulfone

Description:

Methyl-D3 sulfone, also known as methylsulfonylmethane (MSM) in its deuterated form, is a sulfone compound characterized by the presence of a sulfonyl group (–SO2–) attached to a methyl group. Its molecular formula reflects the incorporation of deuterium, which is an isotope of hydrogen, resulting in unique properties compared to its non-deuterated counterpart. This compound is typically a colorless, odorless solid or liquid, depending on its purity and specific conditions. Methyl-D3 sulfone is soluble in polar solvents, such as water and alcohols, and is known for its stability under various conditions. It is often used in research and pharmaceutical applications, particularly in studies involving metabolic pathways and isotopic labeling. The presence of deuterium allows for enhanced tracking in nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. Additionally, methyl-D3 sulfone may exhibit biological activity, contributing to its use in health supplements and potential therapeutic applications, although further research is necessary to fully understand its effects and mechanisms.

Formula: C₂D₆O₂S

InChI: InChI=1/C2H6O2S/c1-5(2,3)4/h1-2H3/i1D3,2D3

InChI key: HHVIBTZHLRERCL-WFGJKAKNSA-N

SMILES: C(S(=O)(=O)C([2H])([2H])[2H])([2H])([2H])[2H]

Synonyms:

• bis[(2H3)methyl] sulfone

Dimethyl Sulfone-d6

CAS: 22230-82-6

Dimethyl Sulfone-d6

Formula: C₂D₆O₂S

Purity: ≥99 atom% D,≥99%

Molecular weight: 100.17

Ref: 54-DE3546

Dimethyl-d6 Sulfone

CAS: 22230-82-6, 67-71-0

Formula: (CD₃)₂SO₂

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 100.04651

Ref: 3U-D5402

Dimethyl-d6 Sulfone

Controlled Product

CAS: 22230-82-6

Applications Dimethyl-d6 Sulfone is the labeled analogue of Dimethyl Sulfone (D479350), It can be used as as a high-temperature solvent for both inorganic and organic substances, due to its polarity and thermal stability. It has been also shown to be used for the treatment of Osteoarthritis, in combination with other compounds.
References Hareau, G., et al.: Encyclo. Reag. Org. Synth. (2003); Kim, L. S., et al.: Osteoarthritis Rsea. Soci., 14 (3), 286 (2006)

Formula: C₂D₆O₂S

Color and Shape: Neat

Molecular weight: 100.17

Ref: TR-D479352

Dimethyl-d6 Sulfone

CAS: 22230-82-6

Formula: C₂H₆O₂S

Molecular weight: 100.17

Ref: BE-RMCD32247